vaccenic acid


(E)-octadec-11-enoic acid; vaccenic acid
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed
CAS RN:[693-72-1]
Formula:C18H34O2; 282.47 g/mol
InChiKey:UWHZIFQPPBDJPM-BQYQJAHWSA-N
SMILES:CCCCCC/C=C/CCCCCCCCCC(O)=O
Molecular structure of vaccenic acid
Melting point:44 °C
Boiling point:360 °C
Log10 partition octanol / water:7.64

Isomers

(Z)-octadec-11-enoic acid
Molecular structure of (Z)-octadec-11-enoic acid
(E)-octadec-9-enoic acid
Molecular structure of (E)-octadec-9-enoic acid
(Z)-octadec-9-enoic acid
Molecular structure of (Z)-octadec-9-enoic acid
petroselinic acid
Molecular structure of petroselinic acid
tetradecyl 2-methylprop-2-enoate
Molecular structure of tetradecyl 2-methylprop-2-enoate
vaccenic acid
Molecular structure of vaccenic acid